C9H13F4NO3 — CID 113435075
2,2,3,3-tetrafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide (PubChem CID 113435075) has the molecular formula C9H13F4NO3 and a molecular weight of 259.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 113435075 |
| Molecular Formula | C9H13F4NO3 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
| SMILES | O=C(NC1(CO)CCOCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H13F4NO3/c10-6(11)9(12,13)7(16)14-8(5-15)1-3-17-4-2-8/h6,15H,1-5H2,(H,14,16) |
| InChIKey | TWPZHWDMVLWPLW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|