C14H22BrNO — CID 113438055
1-(3-bromo-4-ethoxyphenyl)-2,3-dimethylbutan-1-amine (PubChem CID 113438055) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(3-bromo-4-ethoxyphenyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 1-(3-bromo-4-ethoxyphenyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 113438055 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(3-bromo-4-ethoxyphenyl)-2,3-dimethylbutan-1-amine |
| SMILES | CCOc1ccc(C(N)C(C)C(C)C)cc1Br |
| InChI | InChI=1S/C14H22BrNO/c1-5-17-13-7-6-11(8-12(13)15)14(16)10(4)9(2)3/h6-10,14H,5,16H2,1-4H3 |
| InChIKey | XZJIPDZTMRKRJD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |