C12H15BrFNO2 — CID 113440006
3-(4-bromo-2-fluorophenoxy)-2-ethoxycyclobutan-1-amine (PubChem CID 113440006) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenoxy)-2-ethoxycyclobutan-1-amine.
| Compound Name | 3-(4-bromo-2-fluorophenoxy)-2-ethoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 113440006 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-(4-bromo-2-fluorophenoxy)-2-ethoxycyclobutan-1-amine |
| SMILES | CCOC1C(N)CC1Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H15BrFNO2/c1-2-16-12-9(15)6-11(12)17-10-4-3-7(13)5-8(10)14/h3-5,9,11-12H,2,6,15H2,1H3 |
| InChIKey | YFFJPAMONMNLFJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |