About (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione
(1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 11344004) has the molecular formula C4H2O4
and a molecular weight of 114.06 g/mol. Its IUPAC name is (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione.
Molecular Properties
| Compound Name | (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
| PubChem CID | 11344004 |
| Molecular Formula | C4H2O4 |
| Molecular Weight | 114.06 g/mol |
| Exact Mass | 114.00 |
| IUPAC Name | (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1OC(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C4H2O4/c5-3-1-2(7-1)4(6)8-3/h1-2H/t1-,2+ |
| InChIKey | ILABOOGTVTXVFN-XIXRPRMCSA-N |
| XLogP | -1.16 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.06 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The IUPAC name of (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione (CID 11344004) is (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione.
What is the SMILES notation for (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The canonical SMILES for (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is O=C1OC(=O)[C@@H]2O[C@H]12.
What is the InChIKey of (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The InChIKey is ILABOOGTVTXVFN-XIXRPRMCSA-N. The full InChI is InChI=1S/C4H2O4/c5-3-1-2(7-1)4(6)8-3/h1-2H/t1-,2+.
What are the key properties of (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
(1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione has a molecular weight of 114.06 g/mol, XLogP of -1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is sourced from PubChem (CID 11344004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).