About 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium
1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium (PubChem CID 11344005) has the molecular formula C6H13N2+
and a molecular weight of 115.17 g/mol. Its IUPAC name is 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium.
Molecular Properties
| Compound Name | 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium |
| PubChem CID | 11344005 |
| Molecular Formula | C6H13N2+ |
| Molecular Weight | 115.17 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium |
| SMILES | CN1CC[15N+](=[13CH2])CC1 |
| InChI | InChI=1S/C6H13N2/c1-7-3-5-8(2)6-4-7/h1,3-6H2,2H3/q+1/i1+1,7+1 |
| InChIKey | BILHIRMFAGMAJG-SPBYTNOZSA-N |
| XLogP | -0.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium?
The IUPAC name of 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium (CID 11344005) is 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium.
What is the SMILES notation for 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium?
The canonical SMILES for 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium is CN1CC[15N+](=[13CH2])CC1.
What is the InChIKey of 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium?
The InChIKey is BILHIRMFAGMAJG-SPBYTNOZSA-N. The full InChI is InChI=1S/C6H13N2/c1-7-3-5-8(2)6-4-7/h1,3-6H2,2H3/q+1/i1+1,7+1.
What are the key properties of 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium?
1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium has a molecular weight of 115.17 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(113C)methylidene-(415N)1,4-diazinan-4-ium is sourced from PubChem (CID 11344005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).