About 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal
4-(1,3-dioxolan-2-yl)-2-methylidenebutanal (PubChem CID 11344142) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal |
| PubChem CID | 11344142 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal |
| SMILES | C=C(C=O)CCC1OCCO1 |
| InChI | InChI=1S/C8H12O3/c1-7(6-9)2-3-8-10-4-5-11-8/h6,8H,1-5H2 |
| InChIKey | AFSWDXMCXDSXBJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal?
The IUPAC name of 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal (CID 11344142) is 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal is C=C(C=O)CCC1OCCO1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal?
The InChIKey is AFSWDXMCXDSXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-7(6-9)2-3-8-10-4-5-11-8/h6,8H,1-5H2.
What are the key properties of 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal?
4-(1,3-dioxolan-2-yl)-2-methylidenebutanal has a molecular weight of 156.18 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)-2-methylidenebutanal is sourced from PubChem (CID 11344142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).