C16H32N2 — CID 113441643
2-(2-ethylazepan-1-yl)-3,5-dimethylcyclohexan-1-amine (PubChem CID 113441643) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-(2-ethylazepan-1-yl)-3,5-dimethylcyclohexan-1-amine.
| Compound Name | 2-(2-ethylazepan-1-yl)-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 113441643 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-(2-ethylazepan-1-yl)-3,5-dimethylcyclohexan-1-amine |
| SMILES | CCC1CCCCCN1C1C(C)CC(C)CC1N |
| InChI | InChI=1S/C16H32N2/c1-4-14-8-6-5-7-9-18(14)16-13(3)10-12(2)11-15(16)17/h12-16H,4-11,17H2,1-3H3 |
| InChIKey | UDRPUVPJPYXWRK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |