C10H14O2 — CID 11344203
(E)-1-(2,3,4,5-tetrahydrooxepin-7-yl)but-2-en-1-one (PubChem CID 11344203) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (E)-1-(2,3,4,5-tetrahydrooxepin-7-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,3,4,5-tetrahydrooxepin-7-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 11344203 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (E)-1-(2,3,4,5-tetrahydrooxepin-7-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)C1=CCCCCO1 |
| InChI | InChI=1S/C10H14O2/c1-2-6-9(11)10-7-4-3-5-8-12-10/h2,6-7H,3-5,8H2,1H3/b6-2+ |
| InChIKey | GSGQPWKGGISFRY-QHHAFSJGSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|