C9H16O3 — CID 11344267
(3R,4R,5R,6R)-6-ethyl-4-hydroxy-3,5-dimethyloxan-2-one (PubChem CID 11344267) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-ethyl-4-hydroxy-3,5-dimethyloxan-2-one.
| Compound Name | (3R,4R,5R,6R)-6-ethyl-4-hydroxy-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 11344267 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (3R,4R,5R,6R)-6-ethyl-4-hydroxy-3,5-dimethyloxan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C9H16O3/c1-4-7-5(2)8(10)6(3)9(11)12-7/h5-8,10H,4H2,1-3H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | AICXQWPLZWOOSC-LXGUWJNJSA-N |
| XLogP | 0.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |