C8H17NO3 — CID 11344295
(2S,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol (PubChem CID 11344295) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (2S,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol.
| Compound Name | (2S,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol |
|---|---|
| PubChem CID | 11344295 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2S,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](O)[C@@H](O)O1 |
| InChI | InChI=1S/C8H17NO3/c1-5-4-6(9(2)3)7(10)8(11)12-5/h5-8,10-11H,4H2,1-3H3/t5-,6+,7-,8+/m1/s1 |
| InChIKey | ZOYWWAGVGBSJDL-CWKFCGSDSA-N |
| XLogP | -0.60 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |