About 2-(2-methoxyphenyl)-1,3,2-dioxaborolane
2-(2-methoxyphenyl)-1,3,2-dioxaborolane (PubChem CID 11344322) has the molecular formula C9H11BO3
and a molecular weight of 178.00 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-1,3,2-dioxaborolane |
| PubChem CID | 11344322 |
| Molecular Formula | C9H11BO3 |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,3,2-dioxaborolane |
| SMILES | COc1ccccc1B1OCCO1 |
| InChI | InChI=1S/C9H11BO3/c1-11-9-5-3-2-4-8(9)10-12-6-7-13-10/h2-5H,6-7H2,1H3 |
| InChIKey | ONWDCSHQCKLAMG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyphenyl)-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-1,3,2-dioxaborolane?
The IUPAC name of 2-(2-methoxyphenyl)-1,3,2-dioxaborolane (CID 11344322) is 2-(2-methoxyphenyl)-1,3,2-dioxaborolane.
What is the SMILES notation for 2-(2-methoxyphenyl)-1,3,2-dioxaborolane?
The canonical SMILES for 2-(2-methoxyphenyl)-1,3,2-dioxaborolane is COc1ccccc1B1OCCO1.
What is the InChIKey of 2-(2-methoxyphenyl)-1,3,2-dioxaborolane?
The InChIKey is ONWDCSHQCKLAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO3/c1-11-9-5-3-2-4-8(9)10-12-6-7-13-10/h2-5H,6-7H2,1H3.
What are the key properties of 2-(2-methoxyphenyl)-1,3,2-dioxaborolane?
2-(2-methoxyphenyl)-1,3,2-dioxaborolane has a molecular weight of 178.00 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-1,3,2-dioxaborolane is sourced from PubChem (CID 11344322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).