C20H23BClFO4 — CID 113443503
2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 113443503) has the molecular formula C20H23BClFO4 and a molecular weight of 392.66 g/mol. Its IUPAC name is 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113443503 |
| Molecular Formula | C20H23BClFO4 |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[2-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(OCc2c(F)cccc2Cl)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H23BClFO4/c1-19(2)20(3,4)27-21(26-19)15-11-13(24-5)9-10-18(15)25-12-14-16(22)7-6-8-17(14)23/h6-11H,12H2,1-5H3 |
| InChIKey | RBWXUDNLWNTLOW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|