About 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one
2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 11344377) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
Analyze 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The IUPAC name of 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (CID 11344377) is 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The canonical SMILES for 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one is CC1(C)OC(=O)C2=C(CCCC2)O1.
What is the InChIKey of 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The InChIKey is GIBIDZRPNRMPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-10(2)12-8-6-4-3-5-7(8)9(11)13-10/h3-6H2,1-2H3.
What are the key properties of 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one has a molecular weight of 182.22 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one is sourced from PubChem (CID 11344377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).