C9H14N4O3S — CID 113443979
1-(2-methylpyrazol-3-yl)sulfonyl-1,4-diazepan-5-one (PubChem CID 113443979) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-(2-methylpyrazol-3-yl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(2-methylpyrazol-3-yl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 113443979 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(2-methylpyrazol-3-yl)sulfonyl-1,4-diazepan-5-one |
| SMILES | Cn1nccc1S(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C9H14N4O3S/c1-12-9(2-4-11-12)17(15,16)13-6-3-8(14)10-5-7-13/h2,4H,3,5-7H2,1H3,(H,10,14) |
| InChIKey | OUKSAUKHZUCOJA-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |