About 7-ethyl-1H-furo[2,3-g]indazole
7-ethyl-1H-furo[2,3-g]indazole (PubChem CID 11344436) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-ethyl-1H-furo[2,3-g]indazole.
Molecular Properties
| Compound Name | 7-ethyl-1H-furo[2,3-g]indazole |
| PubChem CID | 11344436 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 7-ethyl-1H-furo[2,3-g]indazole |
| SMILES | CCc1cc2c(ccc3cn[nH]c32)o1 |
| InChI | InChI=1S/C11H10N2O/c1-2-8-5-9-10(14-8)4-3-7-6-12-13-11(7)9/h3-6H,2H2,1H3,(H,12,13) |
| InChIKey | KHOPERVAFWZDIU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-1H-furo[2,3-g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1H-furo[2,3-g]indazole?
The IUPAC name of 7-ethyl-1H-furo[2,3-g]indazole (CID 11344436) is 7-ethyl-1H-furo[2,3-g]indazole.
What is the SMILES notation for 7-ethyl-1H-furo[2,3-g]indazole?
The canonical SMILES for 7-ethyl-1H-furo[2,3-g]indazole is CCc1cc2c(ccc3cn[nH]c32)o1.
What is the InChIKey of 7-ethyl-1H-furo[2,3-g]indazole?
The InChIKey is KHOPERVAFWZDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-2-8-5-9-10(14-8)4-3-7-6-12-13-11(7)9/h3-6H,2H2,1H3,(H,12,13).
What are the key properties of 7-ethyl-1H-furo[2,3-g]indazole?
7-ethyl-1H-furo[2,3-g]indazole has a molecular weight of 186.21 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1H-furo[2,3-g]indazole is sourced from PubChem (CID 11344436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).