About 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane
2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane (PubChem CID 11344615) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane |
| PubChem CID | 11344615 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane |
| SMILES | CC(C)N1CNCCC12CCN(C)C2 |
| InChI | InChI=1S/C11H23N3/c1-10(2)14-9-12-6-4-11(14)5-7-13(3)8-11/h10,12H,4-9H2,1-3H3 |
| InChIKey | HGSCQCJQYUGYIO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane?
The IUPAC name of 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane (CID 11344615) is 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane.
What is the SMILES notation for 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane?
The canonical SMILES for 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane is CC(C)N1CNCCC12CCN(C)C2.
What is the InChIKey of 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane?
The InChIKey is HGSCQCJQYUGYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-10(2)14-9-12-6-4-11(14)5-7-13(3)8-11/h10,12H,4-9H2,1-3H3.
What are the key properties of 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane?
2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane has a molecular weight of 197.33 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propan-2-yl-2,6,8-triazaspiro[4.5]decane is sourced from PubChem (CID 11344615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).