C13H11Cl2NO — CID 113446836
1-(3,5-dichlorophenyl)-2-pyridin-3-ylethanol (PubChem CID 113446836) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-pyridin-3-ylethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 113446836 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-pyridin-3-ylethanol |
| SMILES | OC(Cc1cccnc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO/c14-11-5-10(6-12(15)7-11)13(17)4-9-2-1-3-16-8-9/h1-3,5-8,13,17H,4H2 |
| InChIKey | LXUDLQXXMNAWEG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |