C16H18N2 — CID 113446872
2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 113446872) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-naphthalen-2-amine.
| Compound Name | 2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 113446872 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | NC1(Cc2cccnc2)CCc2ccccc2C1 |
| InChI | InChI=1S/C16H18N2/c17-16(10-13-4-3-9-18-12-13)8-7-14-5-1-2-6-15(14)11-16/h1-6,9,12H,7-8,10-11,17H2 |
| InChIKey | RJZGIUJKYSOCSF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |