C12H16N4O3 — CID 113447866
3-[(4-methylpiperazine-1-carbonyl)amino]pyridine-2-carboxylic acid (PubChem CID 113447866) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[(4-methylpiperazine-1-carbonyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 3-[(4-methylpiperazine-1-carbonyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 113447866 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-[(4-methylpiperazine-1-carbonyl)amino]pyridine-2-carboxylic acid |
| SMILES | CN1CCN(C(=O)Nc2cccnc2C(=O)O)CC1 |
| InChI | InChI=1S/C12H16N4O3/c1-15-5-7-16(8-6-15)12(19)14-9-3-2-4-13-10(9)11(17)18/h2-4H,5-8H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | NPFDEJDVJOVZNE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |