About (Z)-tetradec-7-en-2-one
(Z)-tetradec-7-en-2-one (PubChem CID 11344862) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-tetradec-7-en-2-one.
Molecular Properties
| Compound Name | (Z)-tetradec-7-en-2-one |
| PubChem CID | 11344862 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (Z)-tetradec-7-en-2-one |
| SMILES | CCCCCC/C=C\CCCCC(C)=O |
| InChI | InChI=1S/C14H26O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h8-9H,3-7,10-13H2,1-2H3/b9-8- |
| InChIKey | ZFQMGOCRWDJUCX-HJWRWDBZSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tetradec-7-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tetradec-7-en-2-one?
The IUPAC name of (Z)-tetradec-7-en-2-one (CID 11344862) is (Z)-tetradec-7-en-2-one.
What is the SMILES notation for (Z)-tetradec-7-en-2-one?
The canonical SMILES for (Z)-tetradec-7-en-2-one is CCCCCC/C=C\CCCCC(C)=O.
What is the InChIKey of (Z)-tetradec-7-en-2-one?
The InChIKey is ZFQMGOCRWDJUCX-HJWRWDBZSA-N. The full InChI is InChI=1S/C14H26O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h8-9H,3-7,10-13H2,1-2H3/b9-8-.
What are the key properties of (Z)-tetradec-7-en-2-one?
(Z)-tetradec-7-en-2-one has a molecular weight of 210.36 g/mol, XLogP of 4.66, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tetradec-7-en-2-one is sourced from PubChem (CID 11344862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).