About 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline
3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline (PubChem CID 113448703) has the molecular formula C13H14N2OS
and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline.
Molecular Properties
| Compound Name | 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline |
| PubChem CID | 113448703 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline |
| SMILES | Nc1cccc(-c2nc(C3CCOC3)cs2)c1 |
| InChI | InChI=1S/C13H14N2OS/c14-11-3-1-2-9(6-11)13-15-12(8-17-13)10-4-5-16-7-10/h1-3,6,8,10H,4-5,7,14H2 |
| InChIKey | JBAVHIFKFYRBPH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline?
The IUPAC name of 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline (CID 113448703) is 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline.
What is the SMILES notation for 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline?
The canonical SMILES for 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline is Nc1cccc(-c2nc(C3CCOC3)cs2)c1.
What is the InChIKey of 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline?
The InChIKey is JBAVHIFKFYRBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS/c14-11-3-1-2-9(6-11)13-15-12(8-17-13)10-4-5-16-7-10/h1-3,6,8,10H,4-5,7,14H2.
What are the key properties of 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline?
3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline has a molecular weight of 246.34 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]aniline is sourced from PubChem (CID 113448703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).