About benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane
benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane (PubChem CID 11344922) has the molecular formula C14H18Si
and a molecular weight of 214.38 g/mol. Its IUPAC name is benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane.
Molecular Properties
| Compound Name | benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane |
| PubChem CID | 11344922 |
| Molecular Formula | C14H18Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane |
| SMILES | C[Si](C)(Cc1ccccc1)C1=CC=CC1 |
| InChI | InChI=1S/C14H18Si/c1-15(2,14-10-6-7-11-14)12-13-8-4-3-5-9-13/h3-10H,11-12H2,1-2H3 |
| InChIKey | CFMCQONDKZPDPE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane?
The IUPAC name of benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane (CID 11344922) is benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane.
What is the SMILES notation for benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane?
The canonical SMILES for benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane is C[Si](C)(Cc1ccccc1)C1=CC=CC1.
What is the InChIKey of benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane?
The InChIKey is CFMCQONDKZPDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Si/c1-15(2,14-10-6-7-11-14)12-13-8-4-3-5-9-13/h3-10H,11-12H2,1-2H3.
What are the key properties of benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane?
benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane has a molecular weight of 214.38 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-cyclopenta-1,3-dien-1-yl-dimethylsilane is sourced from PubChem (CID 11344922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).