C13H19ClN2S — CID 113449556
2-[(3-chloro-2-pyridinyl)sulfanyl]-1-cyclopentyl-N-methylethanamine (PubChem CID 113449556) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-cyclopentyl-N-methylethanamine.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-cyclopentyl-N-methylethanamine |
|---|---|
| PubChem CID | 113449556 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-cyclopentyl-N-methylethanamine |
| SMILES | CNC(CSc1ncccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C13H19ClN2S/c1-15-12(10-5-2-3-6-10)9-17-13-11(14)7-4-8-16-13/h4,7-8,10,12,15H,2-3,5-6,9H2,1H3 |
| InChIKey | WGLZPPKCPFYAHI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |