C13H13FN2 — CID 11344959
5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole (PubChem CID 11344959) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole.
| Compound Name | 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 11344959 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
| SMILES | Fc1ccc2[nH]cc(C3=CCNCC3)c2c1 |
| InChI | InChI=1S/C13H13FN2/c14-10-1-2-13-11(7-10)12(8-16-13)9-3-5-15-6-4-9/h1-3,7-8,15-16H,4-6H2 |
| InChIKey | NOBJPJHWOFGLFA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |