About S-ethyl (3R,5R)-3,5-dimethyloctanethioate
S-ethyl (3R,5R)-3,5-dimethyloctanethioate (PubChem CID 11344970) has the molecular formula C12H24OS
and a molecular weight of 216.39 g/mol. Its IUPAC name is S-ethyl (3R,5R)-3,5-dimethyloctanethioate.
Molecular Properties
| Compound Name | S-ethyl (3R,5R)-3,5-dimethyloctanethioate |
| PubChem CID | 11344970 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | S-ethyl (3R,5R)-3,5-dimethyloctanethioate |
| SMILES | CCC[C@@H](C)C[C@@H](C)CC(=O)SCC |
| InChI | InChI=1S/C12H24OS/c1-5-7-10(3)8-11(4)9-12(13)14-6-2/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | UUKZQNPLNZGELM-GHMZBOCLSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (3R,5R)-3,5-dimethyloctanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (3R,5R)-3,5-dimethyloctanethioate?
The IUPAC name of S-ethyl (3R,5R)-3,5-dimethyloctanethioate (CID 11344970) is S-ethyl (3R,5R)-3,5-dimethyloctanethioate.
What is the SMILES notation for S-ethyl (3R,5R)-3,5-dimethyloctanethioate?
The canonical SMILES for S-ethyl (3R,5R)-3,5-dimethyloctanethioate is CCC[C@@H](C)C[C@@H](C)CC(=O)SCC.
What is the InChIKey of S-ethyl (3R,5R)-3,5-dimethyloctanethioate?
The InChIKey is UUKZQNPLNZGELM-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H24OS/c1-5-7-10(3)8-11(4)9-12(13)14-6-2/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1.
What are the key properties of S-ethyl (3R,5R)-3,5-dimethyloctanethioate?
S-ethyl (3R,5R)-3,5-dimethyloctanethioate has a molecular weight of 216.39 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (3R,5R)-3,5-dimethyloctanethioate is sourced from PubChem (CID 11344970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).