C12H24ClN — CID 11344985
(2S,3R)-1-butyl-3-chloro-2,5,5-trimethylpiperidine (PubChem CID 11344985) has the molecular formula C12H24ClN and a molecular weight of 217.78 g/mol. Its IUPAC name is (2S,3R)-1-butyl-3-chloro-2,5,5-trimethylpiperidine.
| Compound Name | (2S,3R)-1-butyl-3-chloro-2,5,5-trimethylpiperidine |
|---|---|
| PubChem CID | 11344985 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2S,3R)-1-butyl-3-chloro-2,5,5-trimethylpiperidine |
| SMILES | CCCCN1CC(C)(C)C[C@@H](Cl)[C@@H]1C |
| InChI | InChI=1S/C12H24ClN/c1-5-6-7-14-9-12(3,4)8-11(13)10(14)2/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | RMPBPSMDQPMIGV-WDEREUQCSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|