C12H22F3NO — CID 113450023
N-(2-methoxy-2-methylpropyl)-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 113450023) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(2-methoxy-2-methylpropyl)-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(2-methoxy-2-methylpropyl)-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 113450023 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-(2-methoxy-2-methylpropyl)-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | COC(C)(C)CNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-11(2,17-3)8-16-10-6-4-9(5-7-10)12(13,14)15/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | GELIXIUZRQALCO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |