About 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one
7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one (PubChem CID 11345024) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one.
Molecular Properties
| Compound Name | 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one |
| PubChem CID | 11345024 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one |
| SMILES | O=C1c2cnccc2CCC1CC[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3/c14-11-9(4-6-13(15)16)2-1-8-3-5-12-7-10(8)11/h3,5,7,9H,1-2,4,6H2 |
| InChIKey | HOBLMCFRMHPFOB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one?
The IUPAC name of 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one (CID 11345024) is 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one.
What is the SMILES notation for 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one?
The canonical SMILES for 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one is O=C1c2cnccc2CCC1CC[N+](=O)[O-].
What is the InChIKey of 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one?
The InChIKey is HOBLMCFRMHPFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c14-11-9(4-6-13(15)16)2-1-8-3-5-12-7-10(8)11/h3,5,7,9H,1-2,4,6H2.
What are the key properties of 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one?
7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one has a molecular weight of 220.23 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-nitroethyl)-6,7-dihydro-5H-isoquinolin-8-one is sourced from PubChem (CID 11345024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).