C13H26N2O2 — CID 113450811
5-ethyl-1-[(3-methoxyoxolan-3-yl)methyl]-1,4-diazepane (PubChem CID 113450811) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 5-ethyl-1-[(3-methoxyoxolan-3-yl)methyl]-1,4-diazepane.
| Compound Name | 5-ethyl-1-[(3-methoxyoxolan-3-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 113450811 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 5-ethyl-1-[(3-methoxyoxolan-3-yl)methyl]-1,4-diazepane |
| SMILES | CCC1CCN(CC2(OC)CCOC2)CCN1 |
| InChI | InChI=1S/C13H26N2O2/c1-3-12-4-7-15(8-6-14-12)10-13(16-2)5-9-17-11-13/h12,14H,3-11H2,1-2H3 |
| InChIKey | ZSDUOZWGKDCLNP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |