About N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine
N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 11345111) has the molecular formula C8H8N4O2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 11345111 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ncnc2sc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C8H8N4O2S/c1-11(2)7-5-3-6(12(13)14)15-8(5)10-4-9-7/h3-4H,1-2H3 |
| InChIKey | VYGHEQJFMKRSEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine (CID 11345111) is N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine is CN(C)c1ncnc2sc([N+](=O)[O-])cc12.
What is the InChIKey of N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine?
The InChIKey is VYGHEQJFMKRSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S/c1-11(2)7-5-3-6(12(13)14)15-8(5)10-4-9-7/h3-4H,1-2H3.
What are the key properties of N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine?
N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine has a molecular weight of 224.25 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-6-nitrothieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 11345111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).