C12H13FN2O2 — CID 113452395
N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-2-methoxyacetamide (PubChem CID 113452395) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-2-methoxyacetamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 113452395 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(F)c(C#CCN)c1 |
| InChI | InChI=1S/C12H13FN2O2/c1-17-8-12(16)15-10-4-5-11(13)9(7-10)3-2-6-14/h4-5,7H,6,8,14H2,1H3,(H,15,16) |
| InChIKey | ORHYHKDWZYCKOS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|