C12H13FN2O3 — CID 113452810
2-cyclopropyl-2-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid (PubChem CID 113452810) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 113452810 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-cyclopropyl-2-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cncc(F)c1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H13FN2O3/c1-12(11(17)18,8-2-3-8)15-10(16)7-4-9(13)6-14-5-7/h4-6,8H,2-3H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VKESRTKWSVVEAL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |