C13H11Br2FN2 — CID 113454135
N-[(2-bromo-5-fluorophenyl)methyl]-1-(5-bromo-3-pyridinyl)methanamine (PubChem CID 113454135) has the molecular formula C13H11Br2FN2 and a molecular weight of 374.05 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-(5-bromo-3-pyridinyl)methanamine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(5-bromo-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 113454135 |
| Molecular Formula | C13H11Br2FN2 |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(5-bromo-3-pyridinyl)methanamine |
| SMILES | Fc1ccc(Br)c(CNCc2cncc(Br)c2)c1 |
| InChI | InChI=1S/C13H11Br2FN2/c14-11-3-9(6-18-8-11)5-17-7-10-4-12(16)1-2-13(10)15/h1-4,6,8,17H,5,7H2 |
| InChIKey | NPYVVGBCNHBSRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |