C14H13BrFNO — CID 113454694
2-(5-bromo-3-pyridinyl)-1-(4-fluoro-2-methylphenyl)ethanol (PubChem CID 113454694) has the molecular formula C14H13BrFNO and a molecular weight of 310.17 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1-(4-fluoro-2-methylphenyl)ethanol.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1-(4-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 113454694 |
| Molecular Formula | C14H13BrFNO |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1-(4-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1cc(F)ccc1C(O)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C14H13BrFNO/c1-9-4-12(16)2-3-13(9)14(18)6-10-5-11(15)8-17-7-10/h2-5,7-8,14,18H,6H2,1H3 |
| InChIKey | PGGBMDFRMBRCHC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |