C10H13BrO2 — CID 11345572
(1S,5S)-7-(bromomethyl)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-2-one (PubChem CID 11345572) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is (1S,5S)-7-(bromomethyl)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | (1S,5S)-7-(bromomethyl)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 11345572 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (1S,5S)-7-(bromomethyl)-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-2-one |
| SMILES | C[C@]12O[C@](C)(C=C1CBr)CCC2=O |
| InChI | InChI=1S/C10H13BrO2/c1-9-4-3-8(12)10(2,13-9)7(5-9)6-11/h5H,3-4,6H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | IHIFKSVUIHFRJH-UWVGGRQHSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|