About 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile
2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile (PubChem CID 11345675) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile |
| PubChem CID | 11345675 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile |
| SMILES | CCC[C@@H](CC(=O)N1CCOC1=O)C(C#N)C#N |
| InChI | InChI=1S/C12H15N3O3/c1-2-3-9(10(7-13)8-14)6-11(16)15-4-5-18-12(15)17/h9-10H,2-6H2,1H3/t9-/m0/s1 |
| InChIKey | ZAEFEPZIMHKWLH-VIFPVBQESA-N |
| XLogP | 1.43 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile?
The IUPAC name of 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile (CID 11345675) is 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile.
What is the SMILES notation for 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile?
The canonical SMILES for 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile is CCC[C@@H](CC(=O)N1CCOC1=O)C(C#N)C#N.
What is the InChIKey of 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile?
The InChIKey is ZAEFEPZIMHKWLH-VIFPVBQESA-N. The full InChI is InChI=1S/C12H15N3O3/c1-2-3-9(10(7-13)8-14)6-11(16)15-4-5-18-12(15)17/h9-10H,2-6H2,1H3/t9-/m0/s1.
What are the key properties of 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile?
2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile has a molecular weight of 249.27 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-1-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hexan-3-yl]propanedinitrile is sourced from PubChem (CID 11345675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).