C16H14N2O — CID 11345701
1-[(11Z)-5H-pyrido[3,2-c][1]benzazocin-6-yl]ethanone (PubChem CID 11345701) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-[(11Z)-5H-pyrido[3,2-c][1]benzazocin-6-yl]ethanone.
| Compound Name | 1-[(11Z)-5H-pyrido[3,2-c][1]benzazocin-6-yl]ethanone |
|---|---|
| PubChem CID | 11345701 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[(11Z)-5H-pyrido[3,2-c][1]benzazocin-6-yl]ethanone |
| SMILES | CC(=O)N1Cc2cccnc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C16H14N2O/c1-12(19)18-11-14-6-4-10-17-15(14)9-8-13-5-2-3-7-16(13)18/h2-10H,11H2,1H3/b9-8- |
| InChIKey | RPMKRFYQNIQOET-HJWRWDBZSA-N |
| XLogP | 3.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |