About morpholine-4-carbodithioate;morpholin-4-ium
morpholine-4-carbodithioate;morpholin-4-ium (PubChem CID 11345717) has the molecular formula C9H18N2O2S2
and a molecular weight of 250.39 g/mol. Its IUPAC name is morpholine-4-carbodithioate;morpholin-4-ium.
Molecular Properties
| Compound Name | morpholine-4-carbodithioate;morpholin-4-ium |
| PubChem CID | 11345717 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | morpholine-4-carbodithioate;morpholin-4-ium |
| SMILES | C1COCC[NH2+]1.S=C([S-])N1CCOCC1 |
| InChI | InChI=1S/C5H9NOS2.C4H9NO/c8-5(9)6-1-3-7-4-2-6;1-3-6-4-2-5-1/h1-4H2,(H,8,9);5H,1-4H2 |
| InChIKey | MQYWTQLRFOFUSI-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 38.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze morpholine-4-carbodithioate;morpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-carbodithioate;morpholin-4-ium?
The IUPAC name of morpholine-4-carbodithioate;morpholin-4-ium (CID 11345717) is morpholine-4-carbodithioate;morpholin-4-ium.
What is the SMILES notation for morpholine-4-carbodithioate;morpholin-4-ium?
The canonical SMILES for morpholine-4-carbodithioate;morpholin-4-ium is C1COCC[NH2+]1.S=C([S-])N1CCOCC1.
What is the InChIKey of morpholine-4-carbodithioate;morpholin-4-ium?
The InChIKey is MQYWTQLRFOFUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NOS2.C4H9NO/c8-5(9)6-1-3-7-4-2-6;1-3-6-4-2-5-1/h1-4H2,(H,8,9);5H,1-4H2.
What are the key properties of morpholine-4-carbodithioate;morpholin-4-ium?
morpholine-4-carbodithioate;morpholin-4-ium has a molecular weight of 250.39 g/mol, XLogP of -1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbodithioate;morpholin-4-ium is sourced from PubChem (CID 11345717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).