C12H15NO5S — CID 113457485
2-(butan-2-ylsulfinylmethyl)-6-nitrobenzoic acid (PubChem CID 113457485) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(butan-2-ylsulfinylmethyl)-6-nitrobenzoic acid.
| Compound Name | 2-(butan-2-ylsulfinylmethyl)-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 113457485 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(butan-2-ylsulfinylmethyl)-6-nitrobenzoic acid |
| SMILES | CCC(C)S(=O)Cc1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C12H15NO5S/c1-3-8(2)19(18)7-9-5-4-6-10(13(16)17)11(9)12(14)15/h4-6,8H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | NVHRDQHWMOAGMM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|