About N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide
N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 11345758) has the molecular formula C11H12N2O3S
and a molecular weight of 252.29 g/mol. Its IUPAC name is N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| PubChem CID | 11345758 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | CONC(=O)CC1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C11H12N2O3S/c1-16-13-10(14)6-9-11(15)12-7-4-2-3-5-8(7)17-9/h2-5,9H,6H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | OQWRFCAQZSOIIF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The IUPAC name of N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (CID 11345758) is N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
What is the SMILES notation for N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The canonical SMILES for N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide is CONC(=O)CC1Sc2ccccc2NC1=O.
What is the InChIKey of N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The InChIKey is OQWRFCAQZSOIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-16-13-10(14)6-9-11(15)12-7-4-2-3-5-8(7)17-9/h2-5,9H,6H2,1H3,(H,12,15)(H,13,14).
What are the key properties of N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide has a molecular weight of 252.29 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide is sourced from PubChem (CID 11345758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).