C15H24BrN — CID 113457747
N-[1-(4-bromophenyl)propyl]-3,3-dimethylbutan-2-amine (PubChem CID 113457747) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propyl]-3,3-dimethylbutan-2-amine.
| Compound Name | N-[1-(4-bromophenyl)propyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 113457747 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[1-(4-bromophenyl)propyl]-3,3-dimethylbutan-2-amine |
| SMILES | CCC(NC(C)C(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H24BrN/c1-6-14(17-11(2)15(3,4)5)12-7-9-13(16)10-8-12/h7-11,14,17H,6H2,1-5H3 |
| InChIKey | JQDXXOZOWKXTRM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |