C15H20ClFN2 — CID 113457934
2-(2-chloroethyl)-1-(3,3-dimethylbutan-2-yl)-6-fluorobenzimidazole (PubChem CID 113457934) has the molecular formula C15H20ClFN2 and a molecular weight of 282.79 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3,3-dimethylbutan-2-yl)-6-fluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(3,3-dimethylbutan-2-yl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 113457934 |
| Molecular Formula | C15H20ClFN2 |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3,3-dimethylbutan-2-yl)-6-fluorobenzimidazole |
| SMILES | CC(n1c(CCCl)nc2ccc(F)cc21)C(C)(C)C |
| InChI | InChI=1S/C15H20ClFN2/c1-10(15(2,3)4)19-13-9-11(17)5-6-12(13)18-14(19)7-8-16/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | CTCANTMTSCBSQS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|