About 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide
5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 113458101) has the molecular formula C11H17BrN2O4S
and a molecular weight of 353.24 g/mol. Its IUPAC name is 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide |
| PubChem CID | 113458101 |
| Molecular Formula | C11H17BrN2O4S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(S(N)(=O)=O)c(Br)o1)C(C)(C)C |
| InChI | InChI=1S/C11H17BrN2O4S/c1-6(11(2,3)4)14-10(15)7-5-8(9(12)18-7)19(13,16)17/h5-6H,1-4H3,(H,14,15)(H2,13,16,17) |
| InChIKey | UJESGJRBGDUCLN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide?
The IUPAC name of 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide (CID 113458101) is 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide?
The canonical SMILES for 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide is CC(NC(=O)c1cc(S(N)(=O)=O)c(Br)o1)C(C)(C)C.
What is the InChIKey of 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide?
The InChIKey is UJESGJRBGDUCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2O4S/c1-6(11(2,3)4)14-10(15)7-5-8(9(12)18-7)19(13,16)17/h5-6H,1-4H3,(H,14,15)(H2,13,16,17).
What are the key properties of 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide?
5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide has a molecular weight of 353.24 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,3-dimethylbutan-2-yl)-4-sulfamoylfuran-2-carboxamide is sourced from PubChem (CID 113458101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).