C11H14N2O5 — CID 113458475
2-hydroxy-3-[[2-hydroxyethyl(methyl)carbamoyl]amino]benzoic acid (PubChem CID 113458475) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-hydroxyethyl(methyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-3-[[2-hydroxyethyl(methyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 113458475 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-hydroxy-3-[[2-hydroxyethyl(methyl)carbamoyl]amino]benzoic acid |
| SMILES | CN(CCO)C(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C11H14N2O5/c1-13(5-6-14)11(18)12-8-4-2-3-7(9(8)15)10(16)17/h2-4,14-15H,5-6H2,1H3,(H,12,18)(H,16,17) |
| InChIKey | JKYGEPKQURMVEQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|