C12H8Cl3NO — CID 113458716
2-chloro-6-(2,5-dichlorophenoxy)aniline (PubChem CID 113458716) has the molecular formula C12H8Cl3NO and a molecular weight of 288.56 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dichlorophenoxy)aniline.
| Compound Name | 2-chloro-6-(2,5-dichlorophenoxy)aniline |
|---|---|
| PubChem CID | 113458716 |
| Molecular Formula | C12H8Cl3NO |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2-chloro-6-(2,5-dichlorophenoxy)aniline |
| SMILES | Nc1c(Cl)cccc1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H8Cl3NO/c13-7-4-5-8(14)11(6-7)17-10-3-1-2-9(15)12(10)16/h1-6H,16H2 |
| InChIKey | KNPCZIUPXIHYQW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|