C14H28O2Si — CID 11345885
(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-4-enal (PubChem CID 11345885) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-4-enal.
| Compound Name | (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-4-enal |
|---|---|
| PubChem CID | 11345885 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-4-enal |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C14H28O2Si/c1-9-11(2)13(12(3)10-15)16-17(7,8)14(4,5)6/h9-10,12-13H,1-8H3/b11-9+/t12?,13-/m0/s1 |
| InChIKey | HCOWKEOSDNSERV-HMFBMODYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|