C14H18N2OSi — CID 11345942
9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (PubChem CID 11345942) has the molecular formula C14H18N2OSi and a molecular weight of 258.40 g/mol. Its IUPAC name is 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one.
| Compound Name | 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 11345942 |
| Molecular Formula | C14H18N2OSi |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| SMILES | C[Si](C)(C)C#Cc1cccc2c1NCCNC2=O |
| InChI | InChI=1S/C14H18N2OSi/c1-18(2,3)10-7-11-5-4-6-12-13(11)15-8-9-16-14(12)17/h4-6,15H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | FAJGCMRAOUXNPN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|