About CID 11345973
CID 11345973 (PubChem CID 11345973) has the molecular formula C17H27N2
and a molecular weight of 259.42 g/mol.
Molecular Properties
| Compound Name | CID 11345973 |
| PubChem CID | 11345973 |
| Molecular Formula | C17H27N2 |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)CN1[CH]N(CC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H27N2/c1-16(2,3)11-18-13-19(12-17(4,5)6)15-10-8-7-9-14(15)18/h7-10,13H,11-12H2,1-6H3 |
| InChIKey | SZNHQGKAVJSHSM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11345973 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11345973?
The IUPAC name of CID 11345973 (CID 11345973) is not available.
What is the SMILES notation for CID 11345973?
The canonical SMILES for CID 11345973 is CC(C)(C)CN1[CH]N(CC(C)(C)C)c2ccccc21.
What is the InChIKey of CID 11345973?
The InChIKey is SZNHQGKAVJSHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N2/c1-16(2,3)11-18-13-19(12-17(4,5)6)15-10-8-7-9-14(15)18/h7-10,13H,11-12H2,1-6H3.
What are the key properties of CID 11345973?
CID 11345973 has a molecular weight of 259.42 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11345973 is sourced from PubChem (CID 11345973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).