C16H14Cl2O — CID 113460047
3-(2,6-dichlorophenyl)-2-methyl-1-phenylpropan-1-one (PubChem CID 113460047) has the molecular formula C16H14Cl2O and a molecular weight of 293.19 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-methyl-1-phenylpropan-1-one.
| Compound Name | 3-(2,6-dichlorophenyl)-2-methyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 113460047 |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-methyl-1-phenylpropan-1-one |
| SMILES | CC(Cc1c(Cl)cccc1Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2O/c1-11(16(19)12-6-3-2-4-7-12)10-13-14(17)8-5-9-15(13)18/h2-9,11H,10H2,1H3 |
| InChIKey | RRVQOLZGEUPJHT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |