C11H16N2O3S — CID 113460263
N-[4-(aminomethyl)-2-methoxyphenyl]cyclopropanesulfonamide (PubChem CID 113460263) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[4-(aminomethyl)-2-methoxyphenyl]cyclopropanesulfonamide.
| Compound Name | N-[4-(aminomethyl)-2-methoxyphenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 113460263 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-[4-(aminomethyl)-2-methoxyphenyl]cyclopropanesulfonamide |
| SMILES | COc1cc(CN)ccc1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C11H16N2O3S/c1-16-11-6-8(7-12)2-5-10(11)13-17(14,15)9-3-4-9/h2,5-6,9,13H,3-4,7,12H2,1H3 |
| InChIKey | WNFZQAGHDNRKFS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |